C21H19F5N2O4 — CID 127054378
phenyl 2-[[(2S)-4-methyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]pentanoyl]amino]acetate (PubChem CID 127054378) has the molecular formula C21H19F5N2O4 and a molecular weight of 458.38 g/mol. Its IUPAC name is phenyl 2-[[(2S)-4-methyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]pentanoyl]amino]acetate.
| Compound Name | phenyl 2-[[(2S)-4-methyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 127054378 |
| Molecular Formula | C21H19F5N2O4 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | phenyl 2-[[(2S)-4-methyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]pentanoyl]amino]acetate |
| SMILES | CC(C)C[C@H](NC(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)NCC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C21H19F5N2O4/c1-10(2)8-12(20(30)27-9-13(29)32-11-6-4-3-5-7-11)28-21(31)14-15(22)17(24)19(26)18(25)16(14)23/h3-7,10,12H,8-9H2,1-2H3,(H,27,30)(H,28,31)/t12-/m0/s1 |
| InChIKey | JTRVOECEQQLYFG-LBPRGKRZSA-N |
| XLogP | 3.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|