About 3-chloropropanoyl iodide
3-chloropropanoyl iodide (PubChem CID 12715995) has the molecular formula C3H4ClIO
and a molecular weight of 218.42 g/mol. Its IUPAC name is 3-chloropropanoyl iodide.
Molecular Properties
| Compound Name | 3-chloropropanoyl iodide |
| PubChem CID | 12715995 |
| Molecular Formula | C3H4ClIO |
| Molecular Weight | 218.42 g/mol |
| Exact Mass | 217.90 |
| IUPAC Name | 3-chloropropanoyl iodide |
| SMILES | O=C(I)CCCl |
| InChI | InChI=1S/C3H4ClIO/c4-2-1-3(5)6/h1-2H2 |
| InChIKey | SITMIFRIVRPYOD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropanoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropanoyl iodide?
The IUPAC name of 3-chloropropanoyl iodide (CID 12715995) is 3-chloropropanoyl iodide.
What is the SMILES notation for 3-chloropropanoyl iodide?
The canonical SMILES for 3-chloropropanoyl iodide is O=C(I)CCCl.
What is the InChIKey of 3-chloropropanoyl iodide?
The InChIKey is SITMIFRIVRPYOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4ClIO/c4-2-1-3(5)6/h1-2H2.
What are the key properties of 3-chloropropanoyl iodide?
3-chloropropanoyl iodide has a molecular weight of 218.42 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropanoyl iodide is sourced from PubChem (CID 12715995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).