C8H9N3O3 — CID 127255827
formic acid;4-methoxy-1H-imidazo[4,5-c]pyridine (PubChem CID 127255827) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is formic acid;4-methoxy-1H-imidazo[4,5-c]pyridine.
| Compound Name | formic acid;4-methoxy-1H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 127255827 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | formic acid;4-methoxy-1H-imidazo[4,5-c]pyridine |
| SMILES | COc1nccc2[nH]cnc12.O=CO |
| InChI | InChI=1S/C7H7N3O.CH2O2/c1-11-7-6-5(2-3-8-7)9-4-10-6;2-1-3/h2-4H,1H3,(H,9,10);1H,(H,2,3) |
| InChIKey | UBGVTASTWDQDSX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|