4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen

C7H9N3 — CID 176999050

IUPAC4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen
SMILESCc1nccc2[nH]cnc12.[H][H]
InChIInChI=1S/C7H7N3.H2/c1-5-7-6(2-3-8-5)9-4-10-7;/h2-4H,1H3,(H,9,10);1H
InChIKeyDVZLDSALBNRUPU-UHFFFAOYSA-N
MW135.17 g/mol
LogP1.51
Rot. Bonds

About 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen

4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen (PubChem CID 176999050) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen.

Molecular Properties

Compound Name4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen
PubChem CID176999050
Molecular FormulaC7H9N3
Molecular Weight135.17 g/mol
Exact Mass135.08
IUPAC Name4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen
SMILESCc1nccc2[nH]cnc12.[H][H]
InChIInChI=1S/C7H7N3.H2/c1-5-7-6(2-3-8-5)9-4-10-7;/h2-4H,1H3,(H,9,10);1H
InChIKeyDVZLDSALBNRUPU-UHFFFAOYSA-N
XLogP1.51
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.17
LogP ≤ 51.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen?
The IUPAC name of 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen (CID 176999050) is 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen.
What is the SMILES notation for 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen?
The canonical SMILES for 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen is Cc1nccc2[nH]cnc12.[H][H].
What is the InChIKey of 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen?
The InChIKey is DVZLDSALBNRUPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.H2/c1-5-7-6(2-3-8-5)9-4-10-7;/h2-4H,1H3,(H,9,10);1H.
What are the key properties of 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen?
4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen has a molecular weight of 135.17 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1H-imidazo[4,5-c]pyridine;molecular hydrogen is sourced from PubChem (CID 176999050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).