C8H8IN3 — CID 163753876
4-(1-iodoethyl)-1H-imidazo[4,5-c]pyridine (PubChem CID 163753876) has the molecular formula C8H8IN3 and a molecular weight of 273.08 g/mol. Its IUPAC name is 4-(1-iodoethyl)-1H-imidazo[4,5-c]pyridine.
| Compound Name | 4-(1-iodoethyl)-1H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 163753876 |
| Molecular Formula | C8H8IN3 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 4-(1-iodoethyl)-1H-imidazo[4,5-c]pyridine |
| SMILES | CC(I)c1nccc2[nH]cnc12 |
| InChI | InChI=1S/C8H8IN3/c1-5(9)7-8-6(2-3-10-7)11-4-12-8/h2-5H,1H3,(H,11,12) |
| InChIKey | LSIVKYYNTHWFNH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|