C12H21N3O7Se — CID 127261891
(2S)-5-amino-2-[[3-(2-amino-2-carboxyethyl)selanyl-1-carboxypropyl]amino]-5-oxopentanoic acid (PubChem CID 127261891) has the molecular formula C12H21N3O7Se and a molecular weight of 398.27 g/mol. Its IUPAC name is (2S)-5-amino-2-[[3-(2-amino-2-carboxyethyl)selanyl-1-carboxypropyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[3-(2-amino-2-carboxyethyl)selanyl-1-carboxypropyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 127261891 |
| Molecular Formula | C12H21N3O7Se |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | (2S)-5-amino-2-[[3-(2-amino-2-carboxyethyl)selanyl-1-carboxypropyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(CC[Se]CC(N)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21N3O7Se/c13-6(10(17)18)5-23-4-3-8(12(21)22)15-7(11(19)20)1-2-9(14)16/h6-8,15H,1-5,13H2,(H2,14,16)(H,17,18)(H,19,20)(H,21,22)/t6?,7-,8?/m0/s1 |
| InChIKey | OWBNAAUBKARVQC-WTIBDHCWSA-N |
| XLogP | -1.91 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|