C16H26N4O3S — CID 127752315
N-[1-(1-cyclohexyl-5-methylpyrazole-3-carbonyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 127752315) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-[1-(1-cyclohexyl-5-methylpyrazole-3-carbonyl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-(1-cyclohexyl-5-methylpyrazole-3-carbonyl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 127752315 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[1-(1-cyclohexyl-5-methylpyrazole-3-carbonyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | Cc1cc(C(=O)N2CCC(NS(C)(=O)=O)C2)nn1C1CCCCC1 |
| InChI | InChI=1S/C16H26N4O3S/c1-12-10-15(17-20(12)14-6-4-3-5-7-14)16(21)19-9-8-13(11-19)18-24(2,22)23/h10,13-14,18H,3-9,11H2,1-2H3 |
| InChIKey | MCOMKZKJVIXLIC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |