C29H22N2O3S — CID 12777159
1-benzyl-3-hydroxy-3-[2-oxo-2-(10H-phenothiazin-2-yl)ethyl]indol-2-one (PubChem CID 12777159) has the molecular formula C29H22N2O3S and a molecular weight of 478.57 g/mol. Its IUPAC name is 1-benzyl-3-hydroxy-3-[2-oxo-2-(10H-phenothiazin-2-yl)ethyl]indol-2-one.
| Compound Name | 1-benzyl-3-hydroxy-3-[2-oxo-2-(10H-phenothiazin-2-yl)ethyl]indol-2-one |
|---|---|
| PubChem CID | 12777159 |
| Molecular Formula | C29H22N2O3S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 1-benzyl-3-hydroxy-3-[2-oxo-2-(10H-phenothiazin-2-yl)ethyl]indol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(Cc2ccccc2)c2ccccc21)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C29H22N2O3S/c32-25(20-14-15-27-23(16-20)30-22-11-5-7-13-26(22)35-27)17-29(34)21-10-4-6-12-24(21)31(28(29)33)18-19-8-2-1-3-9-19/h1-16,30,34H,17-18H2 |
| InChIKey | UGWFMSOCMXFOBR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |