C17H18N2O6S2 — CID 12783059
4-(benzenesulfonyl)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid (PubChem CID 12783059) has the molecular formula C17H18N2O6S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid.
| Compound Name | 4-(benzenesulfonyl)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 12783059 |
| Molecular Formula | C17H18N2O6S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4-(benzenesulfonyl)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc(N2CCCC2)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O6S2/c18-27(24,25)15-11-12(17(20)21)10-14(19-8-4-5-9-19)16(15)26(22,23)13-6-2-1-3-7-13/h1-3,6-7,10-11H,4-5,8-9H2,(H,20,21)(H2,18,24,25) |
| InChIKey | OGJGERJACOUQCB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |