About 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine
6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine (PubChem CID 12790839) has the molecular formula C10H9N3S
and a molecular weight of 203.27 g/mol. Its IUPAC name is 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine |
| PubChem CID | 12790839 |
| Molecular Formula | C10H9N3S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine |
| SMILES | C1=CC2=NCCN2N=C1c1cccs1 |
| InChI | InChI=1S/C10H9N3S/c1-2-9(14-7-1)8-3-4-10-11-5-6-13(10)12-8/h1-4,7H,5-6H2 |
| InChIKey | LMFIOLZIPLJPOQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine?
The IUPAC name of 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine (CID 12790839) is 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine.
What is the SMILES notation for 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine?
The canonical SMILES for 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine is C1=CC2=NCCN2N=C1c1cccs1.
What is the InChIKey of 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine?
The InChIKey is LMFIOLZIPLJPOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3S/c1-2-9(14-7-1)8-3-4-10-11-5-6-13(10)12-8/h1-4,7H,5-6H2.
What are the key properties of 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine?
6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine has a molecular weight of 203.27 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine is sourced from PubChem (CID 12790839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).