C10H9N3S — CID 12790839
6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine (PubChem CID 12790839) has the molecular formula C10H9N3S and a molecular weight of 203.27 g/mol. Its IUPAC name is 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine.
| Compound Name | 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 12790839 |
| Molecular Formula | C10H9N3S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 6-thiophen-2-yl-2,3-dihydroimidazo[1,2-b]pyridazine |
| SMILES | C1=CC2=NCCN2N=C1c1cccs1 |
| InChI | InChI=1S/C10H9N3S/c1-2-9(14-7-1)8-3-4-10-11-5-6-13(10)12-8/h1-4,7H,5-6H2 |
| InChIKey | LMFIOLZIPLJPOQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |