C12H20N4O7 — CID 12810527
6-amino-1,3-dimethyl-5-[[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]pyrimidine-2,4-dione (PubChem CID 12810527) has the molecular formula C12H20N4O7 and a molecular weight of 332.31 g/mol. Its IUPAC name is 6-amino-1,3-dimethyl-5-[[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1,3-dimethyl-5-[[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12810527 |
| Molecular Formula | C12H20N4O7 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 6-amino-1,3-dimethyl-5-[[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]pyrimidine-2,4-dione |
| SMILES | Cn1c(N)c(/N=C/[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H20N4O7/c1-15-10(13)7(11(22)16(2)12(15)23)14-3-5(18)8(20)9(21)6(19)4-17/h3,5-6,8-9,17-21H,4,13H2,1-2H3/b14-3+/t5-,6+,8+,9-/m0/s1 |
| InChIKey | YTLQBBIFAPREFH-DLZSJMTMSA-N |
| XLogP | -4.20 |
| TPSA | 183.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|