C13H9Cl3NO2P — CID 12830035
2-phenylimino-2-(trichloromethyl)-1,3,2lambda5-benzodioxaphosphole (PubChem CID 12830035) has the molecular formula C13H9Cl3NO2P and a molecular weight of 348.55 g/mol. Its IUPAC name is 2-phenylimino-2-(trichloromethyl)-1,3,2lambda5-benzodioxaphosphole.
| Compound Name | 2-phenylimino-2-(trichloromethyl)-1,3,2lambda5-benzodioxaphosphole |
|---|---|
| PubChem CID | 12830035 |
| Molecular Formula | C13H9Cl3NO2P |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 2-phenylimino-2-(trichloromethyl)-1,3,2lambda5-benzodioxaphosphole |
| SMILES | ClC(Cl)(Cl)P1(=Nc2ccccc2)Oc2ccccc2O1 |
| InChI | InChI=1S/C13H9Cl3NO2P/c14-13(15,16)20(17-10-6-2-1-3-7-10)18-11-8-4-5-9-12(11)19-20/h1-9H |
| InChIKey | XUZSYUWJEOZSOH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|