C11H18N3OP — CID 12930639
2-methoxy-1,3-dimethyl-2-phenylimino-1,3,2lambda5-diazaphospholidine (PubChem CID 12930639) has the molecular formula C11H18N3OP and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-methoxy-1,3-dimethyl-2-phenylimino-1,3,2lambda5-diazaphospholidine.
| Compound Name | 2-methoxy-1,3-dimethyl-2-phenylimino-1,3,2lambda5-diazaphospholidine |
|---|---|
| PubChem CID | 12930639 |
| Molecular Formula | C11H18N3OP |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-methoxy-1,3-dimethyl-2-phenylimino-1,3,2lambda5-diazaphospholidine |
| SMILES | COP1(=Nc2ccccc2)N(C)CCN1C |
| InChI | InChI=1S/C11H18N3OP/c1-13-9-10-14(2)16(13,15-3)12-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | QZXFOVZMDGVFHW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|