C12H21N4P — CID 12890563
N,N,1,3-tetramethyl-2-phenylimino-1,3,2lambda5-diazaphospholidin-2-amine (PubChem CID 12890563) has the molecular formula C12H21N4P and a molecular weight of 252.30 g/mol. Its IUPAC name is N,N,1,3-tetramethyl-2-phenylimino-1,3,2lambda5-diazaphospholidin-2-amine.
| Compound Name | N,N,1,3-tetramethyl-2-phenylimino-1,3,2lambda5-diazaphospholidin-2-amine |
|---|---|
| PubChem CID | 12890563 |
| Molecular Formula | C12H21N4P |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N,N,1,3-tetramethyl-2-phenylimino-1,3,2lambda5-diazaphospholidin-2-amine |
| SMILES | CN(C)P1(=Nc2ccccc2)N(C)CCN1C |
| InChI | InChI=1S/C12H21N4P/c1-14(2)17(15(3)10-11-16(17)4)13-12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3 |
| InChIKey | DLMOPNNELOZYRU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|