C11H16N3OPS — CID 23416283
2,4,6-trimethyl-3-phenoxy-3-sulfanylidene-5H-1,2,4,3λ5-triazaphosphinine (PubChem CID 23416283) has the molecular formula C11H16N3OPS and a molecular weight of 269.31 g/mol. Its IUPAC name is 2,4,6-trimethyl-3-phenoxy-3-sulfanylidene-5H-1,2,4,3λ5-triazaphosphinine.
| Compound Name | 2,4,6-trimethyl-3-phenoxy-3-sulfanylidene-5H-1,2,4,3λ5-triazaphosphinine |
|---|---|
| PubChem CID | 23416283 |
| Molecular Formula | C11H16N3OPS |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2,4,6-trimethyl-3-phenoxy-3-sulfanylidene-5H-1,2,4,3λ5-triazaphosphinine |
| SMILES | CC1=NN(C)P(=S)(Oc2ccccc2)N(C)C1 |
| InChI | InChI=1S/C11H16N3OPS/c1-10-9-13(2)16(17,14(3)12-10)15-11-7-5-4-6-8-11/h4-8H,9H2,1-3H3 |
| InChIKey | FTLJNHZUKCYGAW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|