C17H15ClN4O5 — CID 12848170
2-(4-chlorophenyl)-3-(2,4-dinitrophenyl)-5-propyl-2H-1,3,4-oxadiazole (PubChem CID 12848170) has the molecular formula C17H15ClN4O5 and a molecular weight of 390.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2,4-dinitrophenyl)-5-propyl-2H-1,3,4-oxadiazole.
| Compound Name | 2-(4-chlorophenyl)-3-(2,4-dinitrophenyl)-5-propyl-2H-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 12848170 |
| Molecular Formula | C17H15ClN4O5 |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2,4-dinitrophenyl)-5-propyl-2H-1,3,4-oxadiazole |
| SMILES | CCCC1=NN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C17H15ClN4O5/c1-2-3-16-19-20(17(27-16)11-4-6-12(18)7-5-11)14-9-8-13(21(23)24)10-15(14)22(25)26/h4-10,17H,2-3H2,1H3 |
| InChIKey | BISLHQPBQLQYTR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 111.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|