C11H10N4O6 — CID 27279078
2-(2,4-dinitrophenyl)-5-ethoxy-4H-pyrazol-3-one (PubChem CID 27279078) has the molecular formula C11H10N4O6 and a molecular weight of 294.22 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-5-ethoxy-4H-pyrazol-3-one.
| Compound Name | 2-(2,4-dinitrophenyl)-5-ethoxy-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 27279078 |
| Molecular Formula | C11H10N4O6 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-5-ethoxy-4H-pyrazol-3-one |
| SMILES | CCOC1=NN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(=O)C1 |
| InChI | InChI=1S/C11H10N4O6/c1-2-21-10-6-11(16)13(12-10)8-4-3-7(14(17)18)5-9(8)15(19)20/h3-5H,2,6H2,1H3 |
| InChIKey | JTODFDFLCXJCEH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 128.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|