C13H15N5O6 — CID 91149168
4-[3-(2,4-dinitrophenyl)-5-oxoimidazolidin-1-yl]butanamide (PubChem CID 91149168) has the molecular formula C13H15N5O6 and a molecular weight of 337.29 g/mol. Its IUPAC name is 4-[3-(2,4-dinitrophenyl)-5-oxoimidazolidin-1-yl]butanamide.
| Compound Name | 4-[3-(2,4-dinitrophenyl)-5-oxoimidazolidin-1-yl]butanamide |
|---|---|
| PubChem CID | 91149168 |
| Molecular Formula | C13H15N5O6 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-[3-(2,4-dinitrophenyl)-5-oxoimidazolidin-1-yl]butanamide |
| SMILES | NC(=O)CCCN1CN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1=O |
| InChI | InChI=1S/C13H15N5O6/c14-12(19)2-1-5-15-8-16(7-13(15)20)10-4-3-9(17(21)22)6-11(10)18(23)24/h3-4,6H,1-2,5,7-8H2,(H2,14,19) |
| InChIKey | XZCUHEFIYFSMCK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 152.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|