C13H13N3O7 — CID 100979103
(3aS,7R,7aS)-5-(2,4-dinitrophenyl)-7-hydroxy-1,3a,4,6,7,7a-hexahydrofuro[3,4-c]pyridin-3-one (PubChem CID 100979103) has the molecular formula C13H13N3O7 and a molecular weight of 323.26 g/mol. Its IUPAC name is (3aS,7R,7aS)-5-(2,4-dinitrophenyl)-7-hydroxy-1,3a,4,6,7,7a-hexahydrofuro[3,4-c]pyridin-3-one.
| Compound Name | (3aS,7R,7aS)-5-(2,4-dinitrophenyl)-7-hydroxy-1,3a,4,6,7,7a-hexahydrofuro[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 100979103 |
| Molecular Formula | C13H13N3O7 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (3aS,7R,7aS)-5-(2,4-dinitrophenyl)-7-hydroxy-1,3a,4,6,7,7a-hexahydrofuro[3,4-c]pyridin-3-one |
| SMILES | O=C1OC[C@H]2[C@@H](O)CN(c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C[C@@H]12 |
| InChI | InChI=1S/C13H13N3O7/c17-12-5-14(4-8-9(12)6-23-13(8)18)10-2-1-7(15(19)20)3-11(10)16(21)22/h1-3,8-9,12,17H,4-6H2/t8-,9-,12+/m1/s1 |
| InChIKey | NRSGPKHLOAOBID-LNLATYFQSA-N |
| XLogP | 0.47 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|