C13H20N2O7Si — CID 57070955
(2,4-dinitrophenyl)methyl-triethoxysilane (PubChem CID 57070955) has the molecular formula C13H20N2O7Si and a molecular weight of 344.40 g/mol. Its IUPAC name is (2,4-dinitrophenyl)methyl-triethoxysilane.
| Compound Name | (2,4-dinitrophenyl)methyl-triethoxysilane |
|---|---|
| PubChem CID | 57070955 |
| Molecular Formula | C13H20N2O7Si |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (2,4-dinitrophenyl)methyl-triethoxysilane |
| SMILES | CCO[Si](Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])(OCC)OCC |
| InChI | InChI=1S/C13H20N2O7Si/c1-4-20-23(21-5-2,22-6-3)10-11-7-8-12(14(16)17)9-13(11)15(18)19/h7-9H,4-6,10H2,1-3H3 |
| InChIKey | FSRPJHQDUAAPBN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|