C15H25N3O7Si — CID 88923083
2,4-dinitro-N-(1-triethoxysilylpropan-2-yl)aniline (PubChem CID 88923083) has the molecular formula C15H25N3O7Si and a molecular weight of 387.47 g/mol. Its IUPAC name is 2,4-dinitro-N-(1-triethoxysilylpropan-2-yl)aniline.
| Compound Name | 2,4-dinitro-N-(1-triethoxysilylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 88923083 |
| Molecular Formula | C15H25N3O7Si |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2,4-dinitro-N-(1-triethoxysilylpropan-2-yl)aniline |
| SMILES | CCO[Si](CC(C)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])(OCC)OCC |
| InChI | InChI=1S/C15H25N3O7Si/c1-5-23-26(24-6-2,25-7-3)11-12(4)16-14-9-8-13(17(19)20)10-15(14)18(21)22/h8-10,12,16H,5-7,11H2,1-4H3 |
| InChIKey | PPJRCOSBWMHHPU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|