C16H28N4O6Si — CID 87429090
N-(5-aminopentan-2-yloxy-ethoxy-propylsilyl)-2,4-dinitroaniline (PubChem CID 87429090) has the molecular formula C16H28N4O6Si and a molecular weight of 400.51 g/mol. Its IUPAC name is N-(5-aminopentan-2-yloxy-ethoxy-propylsilyl)-2,4-dinitroaniline.
| Compound Name | N-(5-aminopentan-2-yloxy-ethoxy-propylsilyl)-2,4-dinitroaniline |
|---|---|
| PubChem CID | 87429090 |
| Molecular Formula | C16H28N4O6Si |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(5-aminopentan-2-yloxy-ethoxy-propylsilyl)-2,4-dinitroaniline |
| SMILES | CCC[Si](Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])(OCC)OC(C)CCCN |
| InChI | InChI=1S/C16H28N4O6Si/c1-4-11-27(25-5-2,26-13(3)7-6-10-17)18-15-9-8-14(19(21)22)12-16(15)20(23)24/h8-9,12-13,18H,4-7,10-11,17H2,1-3H3 |
| InChIKey | XFERDDQGOXPJOQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|