C19H7F21O — CID 12865306
[1,1,1,6,6,7,7,8,8,8-decafluoro-3-(1,1,2,2,2-pentafluoroethyl)-2,5-bis(trifluoromethyl)octa-3,4-dien-2-yl]oxymethylbenzene (PubChem CID 12865306) has the molecular formula C19H7F21O and a molecular weight of 650.22 g/mol. Its IUPAC name is [1,1,1,6,6,7,7,8,8,8-decafluoro-3-(1,1,2,2,2-pentafluoroethyl)-2,5-bis(trifluoromethyl)octa-3,4-dien-2-yl]oxymethylbenzene.
| Compound Name | [1,1,1,6,6,7,7,8,8,8-decafluoro-3-(1,1,2,2,2-pentafluoroethyl)-2,5-bis(trifluoromethyl)octa-3,4-dien-2-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 12865306 |
| Molecular Formula | C19H7F21O |
| Molecular Weight | 650.22 g/mol |
| Exact Mass | 650.02 |
| IUPAC Name | [1,1,1,6,6,7,7,8,8,8-decafluoro-3-(1,1,2,2,2-pentafluoroethyl)-2,5-bis(trifluoromethyl)octa-3,4-dien-2-yl]oxymethylbenzene |
| SMILES | FC(F)(F)C(=C=C(C(F)(F)C(F)(F)F)C(OCc1ccccc1)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H7F21O/c20-12(21,15(27,28)19(38,39)40)10(14(24,25)26)6-9(13(22,23)18(35,36)37)11(16(29,30)31,17(32,33)34)41-7-8-4-2-1-3-5-8/h1-5H,7H2 |
| InChIKey | BSQSOTLXCPOYPN-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.22 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|