C21H16ClNO5 — CID 12869629
3,4,5-triphenyl-1,3-oxazol-3-ium perchlorate (PubChem CID 12869629) has the molecular formula C21H16ClNO5 and a molecular weight of 397.81 g/mol. Its IUPAC name is 3,4,5-triphenyl-1,3-oxazol-3-ium perchlorate.
| Compound Name | 3,4,5-triphenyl-1,3-oxazol-3-ium perchlorate |
|---|---|
| PubChem CID | 12869629 |
| Molecular Formula | C21H16ClNO5 |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 3,4,5-triphenyl-1,3-oxazol-3-ium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2oc[n+](-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16NO.ClHO4/c1-4-10-17(11-5-1)20-21(18-12-6-2-7-13-18)23-16-22(20)19-14-8-3-9-15-19;2-1(3,4)5/h1-16H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HKLVQGWRQFZPFU-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 109.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|