C35H25BrClNO4 — CID 56955557
1-(4-bromophenyl)-2,3,4,5-tetraphenylpyridin-1-ium perchlorate (PubChem CID 56955557) has the molecular formula C35H25BrClNO4 and a molecular weight of 638.95 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,3,4,5-tetraphenylpyridin-1-ium perchlorate.
| Compound Name | 1-(4-bromophenyl)-2,3,4,5-tetraphenylpyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 56955557 |
| Molecular Formula | C35H25BrClNO4 |
| Molecular Weight | 638.95 g/mol |
| Exact Mass | 637.07 |
| IUPAC Name | 1-(4-bromophenyl)-2,3,4,5-tetraphenylpyridin-1-ium perchlorate |
| SMILES | Brc1ccc(-[n+]2cc(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C35H25BrN.ClHO4/c36-30-21-23-31(24-22-30)37-25-32(26-13-5-1-6-14-26)33(27-15-7-2-8-16-27)34(28-17-9-3-10-18-28)35(37)29-19-11-4-12-20-29;2-1(3,4)5/h1-25H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | QNDWEJQNONDMTC-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.95 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|