C20H27NO3 — CID 12881016
ethyl 4-methoxy-1,14-dimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate (PubChem CID 12881016) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is ethyl 4-methoxy-1,14-dimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate.
| Compound Name | ethyl 4-methoxy-1,14-dimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 12881016 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | ethyl 4-methoxy-1,14-dimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-triene-12-carboxylate |
| SMILES | CCOC(=O)C1CC2(C)C3Cc4ccc(OC)cc4C2(C)CC1N3 |
| InChI | InChI=1S/C20H27NO3/c1-5-24-18(22)14-10-20(3)17-8-12-6-7-13(23-4)9-15(12)19(20,2)11-16(14)21-17/h6-7,9,14,16-17,21H,5,8,10-11H2,1-4H3 |
| InChIKey | LJAOHMDKHFQXLW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |