C20H27NO2 — CID 21324574
1-(4-methoxy-1,10,14-trimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-trien-12-yl)ethanone (PubChem CID 21324574) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 1-(4-methoxy-1,10,14-trimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-trien-12-yl)ethanone.
| Compound Name | 1-(4-methoxy-1,10,14-trimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-trien-12-yl)ethanone |
|---|---|
| PubChem CID | 21324574 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-(4-methoxy-1,10,14-trimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2(7),3,5-trien-12-yl)ethanone |
| SMILES | COc1ccc2c(c1)C1(C)CC3C(C(C)=O)CC1(C)C(C2)N3C |
| InChI | InChI=1S/C20H27NO2/c1-12(22)15-10-20(3)18-8-13-6-7-14(23-5)9-16(13)19(20,2)11-17(15)21(18)4/h6-7,9,15,17-18H,8,10-11H2,1-5H3 |
| InChIKey | ZYIBVPPFARVAHG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |