C18H25NO2S — CID 90362090
ethyl (1R,13S)-1,9,13-trimethyl-5-thia-9-azatetracyclo[8.3.1.02,6.08,13]tetradeca-2(6),3-diene-11-carboxylate (PubChem CID 90362090) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is ethyl (1R,13S)-1,9,13-trimethyl-5-thia-9-azatetracyclo[8.3.1.02,6.08,13]tetradeca-2(6),3-diene-11-carboxylate.
| Compound Name | ethyl (1R,13S)-1,9,13-trimethyl-5-thia-9-azatetracyclo[8.3.1.02,6.08,13]tetradeca-2(6),3-diene-11-carboxylate |
|---|---|
| PubChem CID | 90362090 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | ethyl (1R,13S)-1,9,13-trimethyl-5-thia-9-azatetracyclo[8.3.1.02,6.08,13]tetradeca-2(6),3-diene-11-carboxylate |
| SMILES | CCOC(=O)C1C[C@]2(C)C3Cc4sccc4[C@]2(C)CC1N3C |
| InChI | InChI=1S/C18H25NO2S/c1-5-21-16(20)11-9-18(3)15-8-14-12(6-7-22-14)17(18,2)10-13(11)19(15)4/h6-7,11,13,15H,5,8-10H2,1-4H3/t11?,13?,15?,17-,18+/m0/s1 |
| InChIKey | ZSFUEGVORKCUHV-QLLGWSTHSA-N |
| XLogP | 3.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |