C21H21F3N2O2 — CID 129014615
7-[(3S)-3-methylpiperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]-2H-chromen-2-ol (PubChem CID 129014615) has the molecular formula C21H21F3N2O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is 7-[(3S)-3-methylpiperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]-2H-chromen-2-ol.
| Compound Name | 7-[(3S)-3-methylpiperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]-2H-chromen-2-ol |
|---|---|
| PubChem CID | 129014615 |
| Molecular Formula | C21H21F3N2O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 7-[(3S)-3-methylpiperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]-2H-chromen-2-ol |
| SMILES | C[C@H]1CN(c2ccc3c(c2)OC(O)C(c2cccc(C(F)(F)F)c2)=C3)CCN1 |
| InChI | InChI=1S/C21H21F3N2O2/c1-13-12-26(8-7-25-13)17-6-5-15-10-18(20(27)28-19(15)11-17)14-3-2-4-16(9-14)21(22,23)24/h2-6,9-11,13,20,25,27H,7-8,12H2,1H3/t13-,20?/m0/s1 |
| InChIKey | UITRQVOXESRPEU-SZQRVLIRSA-N |
| XLogP | 3.75 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|