C48H56N2 — CID 129021896
9-cyclohexa-1,3-dien-1-yl-3-[9-(3-cyclohexa-1,5-dien-1-yl-5-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-1,2,4a,4b,7,8,8a,9a-octahydrocarbazol-3-yl]-1,2,3,4b,8a,9a-hexahydrocarbazole (PubChem CID 129021896) has the molecular formula C48H56N2 and a molecular weight of 660.99 g/mol. Its IUPAC name is 9-cyclohexa-1,3-dien-1-yl-3-[9-(3-cyclohexa-1,5-dien-1-yl-5-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-1,2,4a,4b,7,8,8a,9a-octahydrocarbazol-3-yl]-1,2,3,4b,8a,9a-hexahydrocarbazole.
| Compound Name | 9-cyclohexa-1,3-dien-1-yl-3-[9-(3-cyclohexa-1,5-dien-1-yl-5-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-1,2,4a,4b,7,8,8a,9a-octahydrocarbazol-3-yl]-1,2,3,4b,8a,9a-hexahydrocarbazole |
|---|---|
| PubChem CID | 129021896 |
| Molecular Formula | C48H56N2 |
| Molecular Weight | 660.99 g/mol |
| Exact Mass | 660.44 |
| IUPAC Name | 9-cyclohexa-1,3-dien-1-yl-3-[9-(3-cyclohexa-1,5-dien-1-yl-5-cyclohexa-2,4-dien-1-ylcyclohexen-1-yl)-1,2,4a,4b,7,8,8a,9a-octahydrocarbazol-3-yl]-1,2,3,4b,8a,9a-hexahydrocarbazole |
| SMILES | C1=CCCC(N2C3CCC(C4=CC5C6C=CCCC6N(C6=CC(C7=CCCC=C7)CC(C7C=CC=CC7)C6)C5CC4)C=C3C3C=CC=CC32)=C1 |
| InChI | InChI=1S/C48H56N2/c1-4-14-33(15-5-1)37-28-38(34-16-6-2-7-17-34)30-40(29-37)50-46-23-13-11-21-42(46)44-32-36(25-27-48(44)50)35-24-26-47-43(31-35)41-20-10-12-22-45(41)49(47)39-18-8-3-9-19-39/h1,3-6,8,10-12,14,16-18,20-22,30-33,35,37-38,41-42,44-48H,2,7,9,13,15,19,23-29H2 |
| InChIKey | BESRBISUTRDTKB-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.99 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|