C24H28NO2+ — CID 129022553
trimethyl-[4-methylidene-6-(9-methylidene-4-oxo-3H-cyclopenta[b]naphthalen-2-yl)-6-oxohexyl]azanium (PubChem CID 129022553) has the molecular formula C24H28NO2+ and a molecular weight of 362.49 g/mol. Its IUPAC name is trimethyl-[4-methylidene-6-(9-methylidene-4-oxo-3H-cyclopenta[b]naphthalen-2-yl)-6-oxohexyl]azanium.
| Compound Name | trimethyl-[4-methylidene-6-(9-methylidene-4-oxo-3H-cyclopenta[b]naphthalen-2-yl)-6-oxohexyl]azanium |
|---|---|
| PubChem CID | 129022553 |
| Molecular Formula | C24H28NO2+ |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | trimethyl-[4-methylidene-6-(9-methylidene-4-oxo-3H-cyclopenta[b]naphthalen-2-yl)-6-oxohexyl]azanium |
| SMILES | C=C(CCC[N+](C)(C)C)CC(=O)C1=CC2=C(C1)C(=O)c1ccccc1C2=C |
| InChI | InChI=1S/C24H28NO2/c1-16(9-8-12-25(3,4)5)13-23(26)18-14-21-17(2)19-10-6-7-11-20(19)24(27)22(21)15-18/h6-7,10-11,14H,1-2,8-9,12-13,15H2,3-5H3/q+1 |
| InChIKey | HEQONTLLUNNVAY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|