C25H27NOSiTi — CID 87357348
N,2-dimethyl-N-[(13-methylidene-4-tetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaenyl)methyl-oxosilyl]propan-2-amine;titanium (PubChem CID 87357348) has the molecular formula C25H27NOSiTi and a molecular weight of 433.45 g/mol. Its IUPAC name is N,2-dimethyl-N-[(13-methylidene-4-tetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaenyl)methyl-oxosilyl]propan-2-amine;titanium.
| Compound Name | N,2-dimethyl-N-[(13-methylidene-4-tetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaenyl)methyl-oxosilyl]propan-2-amine;titanium |
|---|---|
| PubChem CID | 87357348 |
| Molecular Formula | C25H27NOSiTi |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N,2-dimethyl-N-[(13-methylidene-4-tetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaenyl)methyl-oxosilyl]propan-2-amine;titanium |
| SMILES | C=C1c2ccccc2C2=C(CC(C[Si](=O)N(C)C(C)(C)C)=C2)c2ccccc21.[Ti] |
| InChI | InChI=1S/C25H27NOSi.Ti/c1-17-19-10-6-8-12-21(19)23-14-18(16-28(27)26(5)25(2,3)4)15-24(23)22-13-9-7-11-20(17)22;/h6-14H,1,15-16H2,2-5H3; |
| InChIKey | ZGQGGKRMJCDJPV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|