C8H16N2O4S — CID 129028497
1-[(2R)-2-acetamido-3-sulfanylpropoxy]ethyl carbamate (PubChem CID 129028497) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 1-[(2R)-2-acetamido-3-sulfanylpropoxy]ethyl carbamate.
| Compound Name | 1-[(2R)-2-acetamido-3-sulfanylpropoxy]ethyl carbamate |
|---|---|
| PubChem CID | 129028497 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-[(2R)-2-acetamido-3-sulfanylpropoxy]ethyl carbamate |
| SMILES | CC(=O)N[C@@H](CS)COC(C)OC(N)=O |
| InChI | InChI=1S/C8H16N2O4S/c1-5(11)10-7(4-15)3-13-6(2)14-8(9)12/h6-7,15H,3-4H2,1-2H3,(H2,9,12)(H,10,11)/t6?,7-/m1/s1 |
| InChIKey | JQMABDPYRXRSKS-COBSHVIPSA-N |
| XLogP | -0.12 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|