C13H26N2O6S2 — CID 123401309
2-[[1-(2-acetamido-3-sulfanylpropoxy)ethoxy-hydroxymethyl]amino]-3-methyl-3-sulfanylbutanoic acid (PubChem CID 123401309) has the molecular formula C13H26N2O6S2 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[[1-(2-acetamido-3-sulfanylpropoxy)ethoxy-hydroxymethyl]amino]-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | 2-[[1-(2-acetamido-3-sulfanylpropoxy)ethoxy-hydroxymethyl]amino]-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 123401309 |
| Molecular Formula | C13H26N2O6S2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[[1-(2-acetamido-3-sulfanylpropoxy)ethoxy-hydroxymethyl]amino]-3-methyl-3-sulfanylbutanoic acid |
| SMILES | CC(=O)NC(CS)COC(C)OC(O)NC(C(=O)O)C(C)(C)S |
| InChI | InChI=1S/C13H26N2O6S2/c1-7(16)14-9(6-22)5-20-8(2)21-12(19)15-10(11(17)18)13(3,4)23/h8-10,12,15,19,22-23H,5-6H2,1-4H3,(H,14,16)(H,17,18) |
| InChIKey | NEYLLYATDPLTOP-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|