C20H27FN7O6+ — CID 129034241
1-[(2R,3R,4R,5R)-5-[[6-amino-9-(2-ethoxyethyl)purin-1-ium-1-yl]methoxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 129034241) has the molecular formula C20H27FN7O6+ and a molecular weight of 480.48 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[6-amino-9-(2-ethoxyethyl)purin-1-ium-1-yl]methoxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[6-amino-9-(2-ethoxyethyl)purin-1-ium-1-yl]methoxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129034241 |
| Molecular Formula | C20H27FN7O6+ |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[6-amino-9-(2-ethoxyethyl)purin-1-ium-1-yl]methoxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCOCCn1cnc2c(N)[n+](COC[C@H]3O[C@@H](n4ccc(=O)[nH]c4=O)[C@](C)(F)[C@@H]3O)cnc21 |
| InChI | InChI=1S/C20H26FN7O6/c1-3-32-7-6-26-9-23-14-16(22)27(10-24-17(14)26)11-33-8-12-15(30)20(2,21)18(34-12)28-5-4-13(29)25-19(28)31/h4-5,9-10,12,15,18,22,30H,3,6-8,11H2,1-2H3,(H,25,29,31)/p+1/t12-,15-,18-,20-/m1/s1 |
| InChIKey | YHJWYGREDWBSID-VTCYDRLCSA-O |
| XLogP | -1.15 |
| TPSA | 163.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|