About 3-(dimethylamino)propyl dimethyl phosphite
3-(dimethylamino)propyl dimethyl phosphite (PubChem CID 129036212) has the molecular formula C7H18NO3P
and a molecular weight of 195.20 g/mol. Its IUPAC name is 3-(dimethylamino)propyl dimethyl phosphite.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl dimethyl phosphite |
| PubChem CID | 129036212 |
| Molecular Formula | C7H18NO3P |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(dimethylamino)propyl dimethyl phosphite |
| SMILES | COP(OC)OCCCN(C)C |
| InChI | InChI=1S/C7H18NO3P/c1-8(2)6-5-7-11-12(9-3)10-4/h5-7H2,1-4H3 |
| InChIKey | XAWHZNWEENURKN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl dimethyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl dimethyl phosphite?
The IUPAC name of 3-(dimethylamino)propyl dimethyl phosphite (CID 129036212) is 3-(dimethylamino)propyl dimethyl phosphite.
What is the SMILES notation for 3-(dimethylamino)propyl dimethyl phosphite?
The canonical SMILES for 3-(dimethylamino)propyl dimethyl phosphite is COP(OC)OCCCN(C)C.
What is the InChIKey of 3-(dimethylamino)propyl dimethyl phosphite?
The InChIKey is XAWHZNWEENURKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18NO3P/c1-8(2)6-5-7-11-12(9-3)10-4/h5-7H2,1-4H3.
What are the key properties of 3-(dimethylamino)propyl dimethyl phosphite?
3-(dimethylamino)propyl dimethyl phosphite has a molecular weight of 195.20 g/mol, XLogP of 1.47, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl dimethyl phosphite is sourced from PubChem (CID 129036212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).