C30H37N3O6S2 — CID 12903873
14,14-dimethyl-3,9-bis-(4-methylphenyl)sulfonyl-13,15-dioxa-3,9,19-triazatricyclo[9.6.2.012,17]nonadeca-1(18),11(19),12(17)-triene (PubChem CID 12903873) has the molecular formula C30H37N3O6S2 and a molecular weight of 599.78 g/mol. Its IUPAC name is 14,14-dimethyl-3,9-bis-(4-methylphenyl)sulfonyl-13,15-dioxa-3,9,19-triazatricyclo[9.6.2.012,17]nonadeca-1(18),11(19),12(17)-triene.
| Compound Name | 14,14-dimethyl-3,9-bis-(4-methylphenyl)sulfonyl-13,15-dioxa-3,9,19-triazatricyclo[9.6.2.012,17]nonadeca-1(18),11(19),12(17)-triene |
|---|---|
| PubChem CID | 12903873 |
| Molecular Formula | C30H37N3O6S2 |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | 14,14-dimethyl-3,9-bis-(4-methylphenyl)sulfonyl-13,15-dioxa-3,9,19-triazatricyclo[9.6.2.012,17]nonadeca-1(18),11(19),12(17)-triene |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCCN(S(=O)(=O)c3ccc(C)cc3)Cc3ncc(c4c3OC(C)(C)OC4)C2)cc1 |
| InChI | InChI=1S/C30H37N3O6S2/c1-22-8-12-25(13-9-22)40(34,35)32-16-6-5-7-17-33(41(36,37)26-14-10-23(2)11-15-26)20-28-29-27(24(19-32)18-31-28)21-38-30(3,4)39-29/h8-15,18H,5-7,16-17,19-21H2,1-4H3 |
| InChIKey | MUUOQRURKRVDIH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 106.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |