C13H19F2N5 — CID 129044824
2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-amine (PubChem CID 129044824) has the molecular formula C13H19F2N5 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-amine |
|---|---|
| PubChem CID | 129044824 |
| Molecular Formula | C13H19F2N5 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-amine |
| SMILES | [H]/N=C/c1c(N)nc(C(C)(C)C)nc1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H19F2N5/c1-12(2,3)11-18-9(17)8(6-16)10(19-11)20-5-4-13(14,15)7-20/h6,16H,4-5,7H2,1-3H3,(H2,17,18,19)/b16-6+ |
| InChIKey | VGTMTWNXUHAJGN-OMCISZLKSA-N |
| XLogP | 2.20 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|