C9H14N2O4 — CID 129049350
2-amino-1-(4-nitrocyclohexa-1,3-dien-1-yl)propane-1,3-diol (PubChem CID 129049350) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-amino-1-(4-nitrocyclohexa-1,3-dien-1-yl)propane-1,3-diol.
| Compound Name | 2-amino-1-(4-nitrocyclohexa-1,3-dien-1-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 129049350 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-amino-1-(4-nitrocyclohexa-1,3-dien-1-yl)propane-1,3-diol |
| SMILES | NC(CO)C(O)C1=CC=C([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C9H14N2O4/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15/h1,3,8-9,12-13H,2,4-5,10H2 |
| InChIKey | IILORQZFXKFSCU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|