C8H14N2O — CID 129055640
(3Z)-5-(2-aminoethylamino)hexa-1,3,5-trien-2-ol (PubChem CID 129055640) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (3Z)-5-(2-aminoethylamino)hexa-1,3,5-trien-2-ol.
| Compound Name | (3Z)-5-(2-aminoethylamino)hexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 129055640 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (3Z)-5-(2-aminoethylamino)hexa-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)NCCN |
| InChI | InChI=1S/C8H14N2O/c1-7(10-6-5-9)3-4-8(2)11/h3-4,10-11H,1-2,5-6,9H2/b4-3- |
| InChIKey | YJWXNGNEVIFEQC-ARJAWSKDSA-N |
| XLogP | 0.68 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|