C17H18N4O3S — CID 129059855
5-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-3-methyl-2,3-dihydro-1,2-thiazole-4-carboxamide (PubChem CID 129059855) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 5-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-3-methyl-2,3-dihydro-1,2-thiazole-4-carboxamide.
| Compound Name | 5-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-3-methyl-2,3-dihydro-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129059855 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 5-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-3-methyl-2,3-dihydro-1,2-thiazole-4-carboxamide |
| SMILES | COc1ccc(Oc2ccc(NC(=O)C3=C(N)SNC3C)cn2)cc1 |
| InChI | InChI=1S/C17H18N4O3S/c1-10-15(16(18)25-21-10)17(22)20-11-3-8-14(19-9-11)24-13-6-4-12(23-2)5-7-13/h3-10,21H,18H2,1-2H3,(H,20,22) |
| InChIKey | CJIOBUQLVXHYJU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|