C21H43N3 — CID 129103728
5-N-[3-[tert-butyl(methyl)amino]pent-1-en-2-yl]-7,7-dimethyl-6-methylideneoctane-1,5-diamine (PubChem CID 129103728) has the molecular formula C21H43N3 and a molecular weight of 337.60 g/mol. Its IUPAC name is 5-N-[3-[tert-butyl(methyl)amino]pent-1-en-2-yl]-7,7-dimethyl-6-methylideneoctane-1,5-diamine.
| Compound Name | 5-N-[3-[tert-butyl(methyl)amino]pent-1-en-2-yl]-7,7-dimethyl-6-methylideneoctane-1,5-diamine |
|---|---|
| PubChem CID | 129103728 |
| Molecular Formula | C21H43N3 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 337.35 |
| IUPAC Name | 5-N-[3-[tert-butyl(methyl)amino]pent-1-en-2-yl]-7,7-dimethyl-6-methylideneoctane-1,5-diamine |
| SMILES | C=C(NC(CCCCN)C(=C)C(C)(C)C)C(CC)N(C)C(C)(C)C |
| InChI | InChI=1S/C21H43N3/c1-11-19(24(10)21(7,8)9)17(3)23-18(14-12-13-15-22)16(2)20(4,5)6/h18-19,23H,2-3,11-15,22H2,1,4-10H3 |
| InChIKey | GORCDELSAVQIOR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|