C25H29Cl2N3O2S — CID 129125060
N-[(2R)-3-[2-[[(2S)-2-(3,4-dichlorophenyl)cyclopropyl]amino]ethylsulfanyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzamide (PubChem CID 129125060) has the molecular formula C25H29Cl2N3O2S and a molecular weight of 506.50 g/mol. Its IUPAC name is N-[(2R)-3-[2-[[(2S)-2-(3,4-dichlorophenyl)cyclopropyl]amino]ethylsulfanyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzamide.
| Compound Name | N-[(2R)-3-[2-[[(2S)-2-(3,4-dichlorophenyl)cyclopropyl]amino]ethylsulfanyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 129125060 |
| Molecular Formula | C25H29Cl2N3O2S |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | N-[(2R)-3-[2-[[(2S)-2-(3,4-dichlorophenyl)cyclopropyl]amino]ethylsulfanyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzamide |
| SMILES | O=C(N[C@@H](CSCCNC1C[C@H]1c1ccc(Cl)c(Cl)c1)C(=O)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C25H29Cl2N3O2S/c26-20-9-8-18(14-21(20)27)19-15-22(19)28-10-13-33-16-23(25(32)30-11-4-5-12-30)29-24(31)17-6-2-1-3-7-17/h1-3,6-9,14,19,22-23,28H,4-5,10-13,15-16H2,(H,29,31)/t19-,22?,23-/m0/s1 |
| InChIKey | JYPGTOAURDQCGZ-LRSMGMEUSA-N |
| XLogP | 4.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|