About CID 129130128
CID 129130128 (PubChem CID 129130128) has the molecular formula C62H88O19
and a molecular weight of 1137.37 g/mol.
Molecular Properties
| Compound Name | CID 129130128 |
| PubChem CID | 129130128 |
| Molecular Formula | C62H88O19 |
| Molecular Weight | 1137.37 g/mol |
| Exact Mass | 1136.59 |
| IUPAC Name | — |
| SMILES | C=C1CC2CCC34CC5(C)OC6C(O3)C3OC(CCC3OC6C5O4)CC(=O)OC3C(CC4OC(CCC1O2)CC(C)C4=C)OC1CC2OC4(CC2OC1C3C)CC1OC2(CC(C)C3OC5C(CC3O2)OCC5C(O)CO)CC(C)C1O4 |
| InChI | InChI=1S/C62H88O19/c1-27-14-33-8-10-38-28(2)15-35(67-38)12-13-60-26-59(7)58(81-60)57-56(78-59)55(80-60)54-39(71-57)11-9-34(69-54)16-48(65)73-52-32(6)51-44(70-43(52)17-40(68-33)31(27)5)18-41-46(72-51)22-62(75-41)23-47-50(79-62)30(4)21-61(77-47)20-29(3)49-45(76-61)19-42-53(74-49)36(25-66-42)37(64)24-63/h27,29-30,32-47,49-58,63-64H,2,5,8-26H2,1,3-4,6-7H3 |
| InChIKey | NURPSTXUWCVFGF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 205.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 81 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1137.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 19 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 129130128 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 129130128?
The IUPAC name of CID 129130128 (CID 129130128) is not available.
What is the SMILES notation for CID 129130128?
The canonical SMILES for CID 129130128 is C=C1CC2CCC34CC5(C)OC6C(O3)C3OC(CCC3OC6C5O4)CC(=O)OC3C(CC4OC(CCC1O2)CC(C)C4=C)OC1CC2OC4(CC2OC1C3C)CC1OC2(CC(C)C3OC5C(CC3O2)OCC5C(O)CO)CC(C)C1O4.
What is the InChIKey of CID 129130128?
The InChIKey is NURPSTXUWCVFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C62H88O19/c1-27-14-33-8-10-38-28(2)15-35(67-38)12-13-60-26-59(7)58(81-60)57-56(78-59)55(80-60)54-39(71-57)11-9-34(69-54)16-48(65)73-52-32(6)51-44(70-43(52)17-40(68-33)31(27)5)18-41-46(72-51)22-62(75-41)23-47-50(79-62)30(4)21-61(77-47)20-29(3)49-45(76-61)19-42-53(74-49)36(25-66-42)37(64)24-63/h27,29-30,32-47,49-58,63-64H,2,5,8-26H2,1,3-4,6-7H3.
What are the key properties of CID 129130128?
CID 129130128 has a molecular weight of 1137.37 g/mol, XLogP of 5.58, 2 rotatable bonds, 2 hydrogen bond donors, and 19 hydrogen bond acceptors.
Where does this data come from?
All data for CID 129130128 is sourced from PubChem (CID 129130128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).