C26H23BrF2N2O5 — CID 129138434
6-(4-bromophenyl)-N-(2,2-difluoroethyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 129138434) has the molecular formula C26H23BrF2N2O5 and a molecular weight of 561.38 g/mol. Its IUPAC name is 6-(4-bromophenyl)-N-(2,2-difluoroethyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | 6-(4-bromophenyl)-N-(2,2-difluoroethyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 129138434 |
| Molecular Formula | C26H23BrF2N2O5 |
| Molecular Weight | 561.38 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | 6-(4-bromophenyl)-N-(2,2-difluoroethyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | COc1cncc2c1C1(O)C(O)C(C(=O)NCC(F)F)C(c3ccccc3)C1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C26H23BrF2N2O5/c1-35-17-11-30-12-18-22(17)25(34)23(32)20(24(33)31-13-19(28)29)21(14-5-3-2-4-6-14)26(25,36-18)15-7-9-16(27)10-8-15/h2-12,19-21,23,32,34H,13H2,1H3,(H,31,33) |
| InChIKey | FTAMHIUICGRXNH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |