C16H20F2N2O — CID 129142340
1-benzyl-5-(1-ethoxyethenyl)-3,3-difluoropiperidin-4-imine (PubChem CID 129142340) has the molecular formula C16H20F2N2O and a molecular weight of 294.34 g/mol. Its IUPAC name is 1-benzyl-5-(1-ethoxyethenyl)-3,3-difluoropiperidin-4-imine.
| Compound Name | 1-benzyl-5-(1-ethoxyethenyl)-3,3-difluoropiperidin-4-imine |
|---|---|
| PubChem CID | 129142340 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-benzyl-5-(1-ethoxyethenyl)-3,3-difluoropiperidin-4-imine |
| SMILES | [H]/N=C1/C(C(=C)OCC)CN(Cc2ccccc2)CC1(F)F |
| InChI | InChI=1S/C16H20F2N2O/c1-3-21-12(2)14-10-20(11-16(17,18)15(14)19)9-13-7-5-4-6-8-13/h4-8,14,19H,2-3,9-11H2,1H3/b19-15- |
| InChIKey | GPJRFVCETULBJN-CYVLTUHYSA-N |
| XLogP | 3.32 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|