C19H18ClF6N5O3 — CID 129172275
[(3S)-3-[6-[[3-chloro-5-(trifluoromethyl)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluoro-5-methoxypentyl] carbamimidate (PubChem CID 129172275) has the molecular formula C19H18ClF6N5O3 and a molecular weight of 513.83 g/mol. Its IUPAC name is [(3S)-3-[6-[[3-chloro-5-(trifluoromethyl)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluoro-5-methoxypentyl] carbamimidate.
| Compound Name | [(3S)-3-[6-[[3-chloro-5-(trifluoromethyl)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluoro-5-methoxypentyl] carbamimidate |
|---|---|
| PubChem CID | 129172275 |
| Molecular Formula | C19H18ClF6N5O3 |
| Molecular Weight | 513.83 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | [(3S)-3-[6-[[3-chloro-5-(trifluoromethyl)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluoro-5-methoxypentyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCC(F)(F)[C@@H](CCOC)c1nc(NC(=O)c2ncc(C(F)(F)F)cc2Cl)ccc1F |
| InChI | InChI=1S/C19H18ClF6N5O3/c1-33-5-4-10(18(22,23)8-34-17(27)28)14-12(21)2-3-13(30-14)31-16(32)15-11(20)6-9(7-29-15)19(24,25)26/h2-3,6-7,10H,4-5,8H2,1H3,(H3,27,28)(H,30,31,32)/t10-/m0/s1 |
| InChIKey | JRVSDCHADWPLGH-JTQLQIEISA-N |
| XLogP | 4.21 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|