C19H17ClF3N5O3 — CID 129172374
[(3S)-3-[6-[[3-chloro-5-(3-hydroxyprop-1-ynyl)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate (PubChem CID 129172374) has the molecular formula C19H17ClF3N5O3 and a molecular weight of 455.82 g/mol. Its IUPAC name is [(3S)-3-[6-[[3-chloro-5-(3-hydroxyprop-1-ynyl)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate.
| Compound Name | [(3S)-3-[6-[[3-chloro-5-(3-hydroxyprop-1-ynyl)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate |
|---|---|
| PubChem CID | 129172374 |
| Molecular Formula | C19H17ClF3N5O3 |
| Molecular Weight | 455.82 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | [(3S)-3-[6-[[3-chloro-5-(3-hydroxyprop-1-ynyl)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCC(F)(F)[C@@H](C)c1nc(NC(=O)c2ncc(C#CCO)cc2Cl)ccc1F |
| InChI | InChI=1S/C19H17ClF3N5O3/c1-10(19(22,23)9-31-18(24)25)15-13(21)4-5-14(27-15)28-17(30)16-12(20)7-11(8-26-16)3-2-6-29/h4-5,7-8,10,29H,6,9H2,1H3,(H3,24,25)(H,27,28,30)/t10-/m0/s1 |
| InChIKey | DOOWSOQEBAOBTM-JTQLQIEISA-N |
| XLogP | 2.51 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|