C18H17ClF5N5O3 — CID 129172355
[(3S)-3-[6-[[3-chloro-5-(2,2-difluoroethoxy)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate (PubChem CID 129172355) has the molecular formula C18H17ClF5N5O3 and a molecular weight of 481.81 g/mol. Its IUPAC name is [(3S)-3-[6-[[3-chloro-5-(2,2-difluoroethoxy)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate.
| Compound Name | [(3S)-3-[6-[[3-chloro-5-(2,2-difluoroethoxy)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate |
|---|---|
| PubChem CID | 129172355 |
| Molecular Formula | C18H17ClF5N5O3 |
| Molecular Weight | 481.81 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [(3S)-3-[6-[[3-chloro-5-(2,2-difluoroethoxy)pyridine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCC(F)(F)[C@@H](C)c1nc(NC(=O)c2ncc(OCC(F)F)cc2Cl)ccc1F |
| InChI | InChI=1S/C18H17ClF5N5O3/c1-8(18(23,24)7-32-17(25)26)14-11(20)2-3-13(28-14)29-16(30)15-10(19)4-9(5-27-15)31-6-12(21)22/h2-5,8,12H,6-7H2,1H3,(H3,25,26)(H,28,29,30)/t8-/m0/s1 |
| InChIKey | PQAHSWXNYQKANM-QMMMGPOBSA-N |
| XLogP | 3.81 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.81 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|