C39H37N3O7 — CID 129173673
2-[[7'-(N-amino-2,4-dimethylanilino)-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]-(2-prop-2-enoyloxyethyl)amino]ethyl prop-2-enoate (PubChem CID 129173673) has the molecular formula C39H37N3O7 and a molecular weight of 659.74 g/mol. Its IUPAC name is 2-[[7'-(N-amino-2,4-dimethylanilino)-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]-(2-prop-2-enoyloxyethyl)amino]ethyl prop-2-enoate.
| Compound Name | 2-[[7'-(N-amino-2,4-dimethylanilino)-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]-(2-prop-2-enoyloxyethyl)amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 129173673 |
| Molecular Formula | C39H37N3O7 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | 2-[[7'-(N-amino-2,4-dimethylanilino)-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]-(2-prop-2-enoyloxyethyl)amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(CCOC(=O)C=C)c1ccc2c(c1)Oc1cc(C)c(N(N)c3ccc(C)cc3C)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C39H37N3O7/c1-6-36(43)46-18-16-41(17-19-47-37(44)7-2)27-13-14-30-35(22-27)48-34-21-26(5)33(42(40)32-15-12-24(3)20-25(32)4)23-31(34)39(30)29-11-9-8-10-28(29)38(45)49-39/h6-15,20-23H,1-2,16-19,40H2,3-5H3 |
| InChIKey | HSFYETSXTCYTMU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 120.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|